CAS 1260243-04-6
:3-Amino-1H-pyrazole-4-carboxylic acid ethyl ester
Description:
3-Amino-1H-pyrazole-4-carboxylic acid ethyl ester is an organic compound characterized by its pyrazole ring structure, which features an amino group and a carboxylic acid moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. The ethyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, making it a versatile intermediate in organic synthesis. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of new drugs or agrochemicals. Its specific applications and reactivity can vary based on the functional groups present and the conditions under which it is used. As with any chemical substance, appropriate safety measures should be taken when handling it in a laboratory setting.
Formula:C6H9N3O2
InChI:InChI=1/C6H9N3O2/c1-2-11-6(10)4-3-8-9-5(4)7/h3H,2H2,1H3,(H3,7,8,9)
SMILES:CCOC(=O)c1c[nH][nH]c1=N
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3-amino-, ethyl ester
- 1H-Pyrazole-4-carboxylic acid, 5-amino-, ethyl ester
- Ethyl 3-amino-1H-pyrazole-4-carboxylate
- Ethyl 5-amino-1H-pyrazole-4-carboxylate
- Ethyl-5-amino-1H-pyrazol-4-carboxylat
- 5-Amino-1H-pyrazole-4-carboxylic acid ethyl ester
- Ethyl 5-Amino-1H-4-Pyrazolecarboxylate
- 3-Amino-4-carbethoxypyrazole
- Ethyl 3-amino-4-pyrazolecarboxylate
- Ethyl 3-amino-4-pyarazolecarboxylate
- 3-Amino-4-pyrazolecarboxylic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 3-amino-1H-pyrazole-4-carboxylate
CAS:Formula:C6H9N3O2Purity:97%Color and Shape:SolidMolecular weight:155.1546Ethyl 5-Amino-1H-Pyrazole-4-Carboxylate
CAS:<p>Ethyl 5-Amino-1H-Pyrazole-4-Carboxylate</p>Purity:96%Molecular weight:155.15g/mol
