CAS 1260243-51-3

Ethyl 4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate

Description:

Ethyl 4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine framework. This compound features a trifluoromethyl group, which is known for enhancing lipophilicity and biological activity. The presence of the ethyl ester group contributes to its solubility and reactivity, making it a potential candidate for various chemical reactions. The tetrahydro configuration indicates that the compound contains a saturated ring system, which can influence its stability and interaction with biological targets. Additionally, the compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways. As with many compounds containing fluorine, it may also exhibit distinct electronic properties that can affect its reactivity and interactions with other molecules. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₀H₁₂F₃N₃O₂

InChI: InChI=1S/C10H12F3N3O2/c1-2-18-9(17)6-5-15-16-7(10(11,12)13)3-4-14-8(6)16/h5,7,14H,2-4H2,1H3

InChI key: InChIKey=QTSSMEYPNRQYHJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1N2C(=C(C(OCC)=O)C=N2)NCC1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 4,5,6,7-tetrahydro-7-(trifluoromethyl)-, ethyl ester
• Ethyl 4,5,6,7-tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate