CymitQuimica logo

CAS 1260374-06-8

:

4-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine

Description:
4-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine is a chemical compound characterized by its complex structure, which includes a morpholine ring and a pyridine moiety, along with a boron-containing dioxaborolane group. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The presence of the boron atom in the dioxaborolane contributes to its reactivity, making it useful in various coupling reactions, such as Suzuki-Miyaura cross-coupling. The morpholine ring adds to the compound's solubility and potential biological activity, while the pyridine ring can enhance its electronic properties. Overall, this compound exemplifies the integration of heterocyclic chemistry and organoboron chemistry, showcasing its potential applications in diverse chemical reactions and as a building block in drug discovery. Its specific properties, such as solubility, stability, and reactivity, would depend on the conditions under which it is used.
Formula:C15H23BN2O3
InChI:InChI=1S/C15H23BN2O3/c1-14(2)15(3,4)21-16(20-14)12-6-5-7-13(17-12)18-8-10-19-11-9-18/h5-7H,8-11H2,1-4H3
InChI key:InChIKey=VJOXMDVUOGSGDX-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(C=CC2)N3CCOCC3
Synonyms:
  • 4-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine
  • Morpholine, 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-
  • 4-[6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.