CAS 1260379-26-7

Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate

Description:

Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of difluoromethyl groups at the 3 and 5 positions of the pyrazole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The acetate functional group contributes to its reactivity, making it a versatile intermediate in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is important to handle it with care, as it may exhibit toxicity or environmental hazards. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where it could serve as a building block for more complex molecules. As with any chemical, proper safety protocols should be followed during handling and experimentation.

Formula: C₈H₈F₄N₂O₂

InChI: InChI=1S/C8H8F4N2O2/c1-16-6(15)3-14-5(8(11)12)2-4(13-14)7(9)10/h2,7-8H,3H2,1H3

InChI key: InChIKey=BUIGGBLUFZPLKT-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C(C(F)F)=CC(C(F)F)=N1

Synonyms:

• Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate
• 1H-Pyrazole-1-acetic acid, 3,5-bis(difluoromethyl)-, methyl ester