CAS 1260379-26-7
:Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate
Description:
Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of difluoromethyl groups at the 3 and 5 positions of the pyrazole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The acetate functional group contributes to its reactivity, making it a versatile intermediate in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is important to handle it with care, as it may exhibit toxicity or environmental hazards. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where it could serve as a building block for more complex molecules. As with any chemical, proper safety protocols should be followed during handling and experimentation.
Formula:C8H8F4N2O2
InChI:InChI=1S/C8H8F4N2O2/c1-16-6(15)3-14-5(8(11)12)2-4(13-14)7(9)10/h2,7-8H,3H2,1H3
InChI key:InChIKey=BUIGGBLUFZPLKT-UHFFFAOYSA-N
SMILES:C(C(OC)=O)N1C(C(F)F)=CC(C(F)F)=N1
Synonyms:- Methyl 3,5-bis(difluoromethyl)-1H-pyrazole-1-acetate
- 1H-Pyrazole-1-acetic acid, 3,5-bis(difluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.