CAS 1260379-32-5

Methyl 5-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxylate

Description:

Methyl 5-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxylate is a chemical compound characterized by its complex structure, which includes a furan ring and a pyrazole moiety. The presence of a bromine atom and a nitro group on the pyrazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic ester, with the methyl ester functional group providing solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the pyrazole and furan rings, which are often associated with various biological activities. Additionally, the compound's unique substituents may influence its pharmacokinetic properties, such as absorption and metabolism. As with many synthetic organic compounds, safety and handling precautions are essential, given the presence of halogenated and nitro groups, which can pose environmental and health risks.

Formula: C₁₀H₈BrN₃O₅

InChI: InChI=1S/C10H8BrN3O5/c1-18-10(15)8-3-2-6(19-8)4-13-5-7(11)9(12-13)14(16)17/h2-3,5H,4H2,1H3

InChI key: InChIKey=HJZGZEFBKGJMRI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=NN(CC=2OC(C(OC)=O)=CC2)C=C1Br

Synonyms:

• 2-Furancarboxylic acid, 5-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-, methyl ester
• Methyl 5-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxylate