CymitQuimica logo

CAS 1260379-37-0

:

N,N,5-Trimethyl-3-nitro-1H-pyrazole-1-acetamide

Description:
N,N,5-Trimethyl-3-nitro-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of the nitro group (-NO2) at the 3-position and the acetamide group (-C(=O)NH2) at the 1-position contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The three methyl groups at the 5-position enhance its lipophilicity, which can influence its solubility and biological activity. This compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and reductions, depending on the conditions. As with many nitro compounds, it may also be sensitive to reduction, leading to the formation of amines. Safety and handling precautions should be observed due to the potential hazards associated with nitro compounds.
Formula:C8H12N4O3
InChI:InChI=1S/C8H12N4O3/c1-6-4-7(12(14)15)9-11(6)5-8(13)10(2)3/h4H,5H2,1-3H3
InChI key:InChIKey=RWWJGWPGAQEAJJ-UHFFFAOYSA-N
SMILES:C(C(N(C)C)=O)N1N=C(N(=O)=O)C=C1C
Synonyms:
  • 1H-Pyrazole-1-acetamide, N,N,5-trimethyl-3-nitro-
  • N,N,5-Trimethyl-3-nitro-1H-pyrazole-1-acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.