CAS 1260379-39-2

4-Chloro-1-tricyclo[3.3.1.13,7]dec-1-yl-1H-pyrazole-3-carboxylic acid

Description:

4-Chloro-1-tricyclo[3.3.1.13,7]dec-1-yl-1H-pyrazole-3-carboxylic acid, with the CAS number 1260379-39-2, is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazole ring and a tricyclic decane framework. The presence of a chloro substituent indicates that it has halogenated properties, which can influence its reactivity and solubility. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its structural complexity suggests that it could interact with biological targets in unique ways, making it of interest in medicinal chemistry. Additionally, the specific arrangement of atoms and functional groups can affect its physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic applications.

Formula: C₁₄H₁₇ClN₂O₂

InChI: InChI=1S/C14H17ClN2O2/c15-11-7-17(16-12(11)13(18)19)14-4-8-1-9(5-14)3-10(2-8)6-14/h7-10H,1-6H2,(H,18,19)

InChI key: InChIKey=ZSOXKQMFUBNMGF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN(C23CC4CC(C2)CC(C3)C4)C=C1Cl

Synonyms:

• 4-Chloro-1-tricyclo[3.3.1.13,7]dec-1-yl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 4-chloro-1-tricyclo[3.3.1.13,7]dec-1-yl-

1-(Adamantan-1-yl)-4-chloro-1H-pyrazole-3-carboxylic acid

CAS: 1260379-39-2

Versatile small molecule scaffold

Formula: C₁₄H₁₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 280.75 g/mol

Ref: 3D-KAC37939