CymitQuimica logo

CAS 1260379-42-7

:

1-(2-Chloro-4-nitrophenyl)-3-methyl-1H-pyrazole

Description:
1-(2-Chloro-4-nitrophenyl)-3-methyl-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro and a nitro substituent on the phenyl ring, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chloro group can enhance the compound's electrophilic properties, while the nitro group may influence its electronic characteristics and solubility. The methyl group at the 3-position of the pyrazole ring can affect the steric and electronic properties, potentially impacting its biological activity. As a synthetic intermediate, this compound may be involved in the development of novel therapeutic agents or agrochemicals. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can pose health and environmental risks.
Formula:C10H8ClN3O2
InChI:InChI=1S/C10H8ClN3O2/c1-7-4-5-13(12-7)10-3-2-8(14(15)16)6-9(10)11/h2-6H,1H3
InChI key:InChIKey=ORQFZKKHYROFIN-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(N(=O)=O)=C1)N2N=C(C)C=C2
Synonyms:
  • 1-(2-Chloro-4-nitrophenyl)-3-methyl-1H-pyrazole
  • 1H-Pyrazole, 1-(2-chloro-4-nitrophenyl)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.