CAS 1260381-35-8

7-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile

Description:

7-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 7-position and a cyano group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the cyano group, which can participate in various chemical reactions. Additionally, the chlorine substituent may influence the compound's lipophilicity and biological interactions. As with many heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further research in material science or as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₄ClN₃

InChI: InChI=1S/C8H4ClN3/c9-7-4-11-3-6-5(1-10)2-12-8(6)7/h2-4,12H

InChI key: InChIKey=SSZORTDUVAUZRP-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2C(=C(Cl)C=NC2)NC1

Synonyms:

• 7-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile
• 1H-Pyrrolo[3,2-c]pyridine-3-carbonitrile, 7-chloro-