CAS 1260381-62-1

Methyl 2-amino-4-chloro-7-benzothiazolecarboxylate

Description:

Methyl 2-amino-4-chloro-7-benzothiazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring, an amino group, and a chloro substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino and carboxylate functional groups. The chloro substituent can influence its reactivity and solubility in various solvents. Methyl 2-amino-4-chloro-7-benzothiazolecarboxylate may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of new therapeutic agents. Its molecular interactions can be studied for applications in medicinal chemistry, where modifications to the benzothiazole framework could lead to enhanced efficacy or selectivity. Additionally, the compound's properties may be explored in agrochemical applications, given the importance of benzothiazole derivatives in crop protection. As with any chemical, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.

Formula: C₉H₇ClN₂O₂S

InChI: InChI=1S/C9H7ClN2O2S/c1-14-8(13)4-2-3-5(10)6-7(4)15-9(11)12-6/h2-3H,1H3,(H2,11,12)

InChI key: InChIKey=NEEZRUOQFQXCQB-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=C(Cl)C=C1)N=C(N)S2

Synonyms:

• 7-Benzothiazolecarboxylic acid, 2-amino-4-chloro-, methyl ester
• Methyl 2-amino-4-chloro-7-benzothiazolecarboxylate