CAS 1260381-69-8

Methyl 2-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate

Description:

Methyl 2-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of an iodine atom at the 2-position and a methoxycarbonyl group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in the synthesis of biologically active molecules. The iodine substituent can also serve as a useful handle for further functionalization. As with many halogenated compounds, it may exhibit specific biological activities, warranting investigation for potential pharmaceutical applications. Safety and handling precautions should be observed due to the presence of iodine and the potential for toxicity associated with heterocyclic compounds.

Formula: C₉H₇IN₂O₂

InChI: InChI=1S/C9H7IN2O2/c1-14-9(13)5-2-7-6(11-4-5)3-8(10)12-7/h2-4,12H,1H3

InChI key: InChIKey=MRLHLBKJOLOBSH-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2C(C=C(I)N2)=NC1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 2-iodo-, methyl ester
• Methyl 2-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate