CAS 1260382-26-0

6-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile

Description:

6-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a methoxy group (-OCH3) enhances its solubility and reactivity, while the carbonitrile group (-C≡N) introduces a polar functional group that can participate in various chemical reactions, including nucleophilic additions and substitutions. This compound is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting neurological disorders or other therapeutic areas. Its molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for further research in organic synthesis and drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy and carbonitrile groups, which may affect its interaction with biological targets. Overall, 6-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile represents a valuable structure for exploration in both synthetic and medicinal chemistry.

Formula: C₉H₇N₃O

InChI: InChI=1S/C9H7N3O/c1-13-9-2-8-7(5-12-9)6(3-10)4-11-8/h2,4-5,11H,1H3

InChI key: InChIKey=RHDFVAUBAHYIIA-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2C(=CC(OC)=NC2)NC1

Synonyms:

• 6-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile
• 1H-Pyrrolo[3,2-c]pyridine-3-carbonitrile, 6-methoxy-