CymitQuimica logo

CAS 1260382-28-2

:

6-Methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid

Description:
6-Methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a methoxy group (-OCH3) at the 6-position enhances its solubility and reactivity, while the carboxylic acid functional group (-COOH) at the 2-position provides acidic characteristics, allowing for potential interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential for hydrogen bonding and interactions with various biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, which are essential for synthetic applications. Overall, 6-Methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-14-5-2-7-6(10-4-5)3-8(11-7)9(12)13/h2-4,11H,1H3,(H,12,13)
InChI key:InChIKey=WKZWTNLQEOHABN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC=2C(C1)=NC=C(OC)C2
Synonyms:
  • 6-Methoxy-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid
  • 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, 6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.