CAS 1260382-52-2

1H-Indole-3-carboxylic acid, 6-methoxy-2-methyl-

Description:

1H-Indole-3-carboxylic acid, 6-methoxy-2-methyl- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group at the 3-position and a methoxy group at the 6-position, along with a methyl group at the 2-position of the indole ring. The presence of these substituents contributes to its unique chemical properties, including potential acidity due to the carboxylic acid group and possible electron-donating effects from the methoxy group. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, 1H-Indole-3-carboxylic acid, 6-methoxy-2-methyl- represents a class of compounds that may have significant implications in various chemical and biological applications.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1S/C11H11NO3/c1-6-10(11(13)14)8-4-3-7(15-2)5-9(8)12-6/h3-5,12H,1-2H3,(H,13,14)

InChI key: InChIKey=KSBLPMVUPUYCTQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1C)=CC(OC)=CC2

Synonyms:

• 6-Methoxy-2-methyl-1H-indole-3-carboxylic acid
• 1H-Indole-3-carboxylic acid, 6-methoxy-2-methyl-