CAS 1260382-65-7
:5-Amino-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile
Description:
5-Amino-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a cyano group, enhancing its reactivity and potential applications in medicinal chemistry and material science. The presence of the amino group allows for hydrogen bonding and potential interactions with biological targets, while the cyano group can participate in nucleophilic reactions or serve as a functional handle for further chemical modifications. Its structure suggests potential use in the development of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 5-Amino-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile is a versatile compound with significant implications in research and development within the fields of organic chemistry and drug discovery.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-4-7-6(10)3-5-1-2-11-8(5)12-7/h1-3H,10H2,(H,11,12)
InChI key:InChIKey=KYSJLACIXHMNIX-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C2C(=CC1N)C=CN2
Synonyms:- 5-Amino-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile
- 1H-Pyrrolo[2,3-b]pyridine-6-carbonitrile, 5-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.