CAS 1260382-92-0
:3-Acetyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
Description:
3-Acetyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which combines elements of both pyrrole and pyridine. This compound features an acetyl group and a cyano group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the carbonitrile functional group enhances its ability to participate in nucleophilic reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound's aromatic nature may confer stability and influence its electronic properties. It is often studied for its biological activity, particularly in the context of drug development, due to the presence of nitrogen atoms in its structure, which can interact with biological targets. The compound's solubility, melting point, and other physical properties can vary based on the solvent and conditions used, making it important to consider these factors in practical applications. Overall, 3-Acetyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile represents a significant compound in the field of organic and medicinal chemistry.
Formula:C10H7N3O
InChI:InChI=1S/C10H7N3O/c1-6(14)8-5-13-9-7(4-11)2-3-12-10(8)9/h2-3,5,13H,1H3
InChI key:InChIKey=WZIKILBFOQAHAZ-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=2C(=C(C#N)C=CN2)NC1
Synonyms:- 3-Acetyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
- 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-acetyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.