CAS 1260382-99-7

7-Bromo-4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine

Description:

7-Bromo-4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both bromine and trifluoromethyl functional groups. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical syntheses. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its biological activity, often enhancing the potency of pharmaceuticals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's unique electronic properties, due to the electronegative fluorine atoms, may affect its interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 7-Bromo-4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₈H₄BrF₃N₂

InChI: InChI=1S/C8H4BrF3N2/c9-5-3-14-7(8(10,11)12)4-1-2-13-6(4)5/h1-3,13H

InChI key: InChIKey=MBXXQEGQCLMMEZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(=C(Br)C=N1)NC=C2

Synonyms:

• 7-Bromo-4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine
• 1H-Pyrrolo[3,2-c]pyridine, 7-bromo-4-(trifluoromethyl)-

7-Bromo-4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine

CAS: 1260382-99-7

Formula: C₈H₄BrF₃N₂

Molecular weight: 265.0300

Ref: IN-DA000QSS