CAS 1260383-45-6
:Methyl 2-iodo-1H-pyrrolo[3,2-c]pyridine-7-carboxylate
Description:
Methyl 2-iodo-1H-pyrrolo[3,2-c]pyridine-7-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a pyridine ring fused with a pyrrole moiety. The presence of the iodine atom at the 2-position of the pyrrole ring introduces significant reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals. The carboxylate group contributes to its polar nature, enhancing its solubility in polar solvents. This compound is typically synthesized through multi-step reactions involving halogenation and esterification processes. Its unique structure allows for potential applications in medicinal chemistry, especially in the design of bioactive molecules. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions under which it is synthesized and purified. Overall, Methyl 2-iodo-1H-pyrrolo[3,2-c]pyridine-7-carboxylate represents a significant class of compounds with diverse applications in chemical research and development.
Formula:C9H7IN2O2
InChI:InChI=1S/C9H7IN2O2/c1-14-9(13)6-4-11-3-5-2-7(10)12-8(5)6/h2-4,12H,1H3
InChI key:InChIKey=ZGTMSWQQXDRLMB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(C=C(I)N2)=CN=C1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine-7-carboxylic acid, 2-iodo-, methyl ester
- Methyl 2-iodo-1H-pyrrolo[3,2-c]pyridine-7-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.