
CAS 1260383-70-7
:7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile
Description:
7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. The presence of a methyl group at the 7-position and a cyano group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine and pyrrole moieties, which are often associated with bioactive compounds. The cyano group may also enhance its reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by factors like substituent effects and intermolecular interactions. Overall, 7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile represents a valuable structure for further research and application in various chemical fields.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-6-3-11-5-8-7(2-10)4-12-9(6)8/h3-5,12H,1H3
InChI key:InChIKey=VIQKGQMGTFSPPK-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(=C(C)C=NC2)NC1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine-3-carbonitrile, 7-methyl-
- 7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.