CAS 1260384-01-7
:Imidazo[1,2-a]pyridine-2-acetaldehyde
Description:
Imidazo[1,2-a]pyridine-2-acetaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features an aldehyde functional group, which is reactive and can participate in various chemical reactions, such as condensation and oxidation. The presence of the acetaldehyde moiety enhances its potential for further derivatization, making it a valuable intermediate in organic synthesis. Imidazo[1,2-a]pyridine derivatives are known for their biological activity, including antimicrobial and antitumor properties, which may be attributed to the structural features of the imidazo and pyridine rings. The compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its application in research and industry. Overall, Imidazo[1,2-a]pyridine-2-acetaldehyde is a significant compound in medicinal chemistry and materials science, with ongoing research exploring its potential uses and mechanisms of action.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c12-6-4-8-7-11-5-2-1-3-9(11)10-8/h1-3,5-7H,4H2
InChI key:InChIKey=DRESJGGIRLYPSD-UHFFFAOYSA-N
SMILES:C(C=O)C=1N=C2N(C1)C=CC=C2
Synonyms:- Imidazo[1,2-a]pyridine-2-acetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.