CymitQuimica logo

CAS 1260384-08-4

:

6-Chloro-3-iodo-5-methyl-1H-indazole

Description:
6-Chloro-3-iodo-5-methyl-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of chlorine and iodine substituents at specific positions on the indazole structure contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity due to its aromatic nature, which can influence its solubility in organic solvents. The chlorine and iodine atoms can also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the methyl group at the 5-position can affect the compound's steric and electronic properties, potentially influencing its biological activity. Compounds like 6-Chloro-3-iodo-5-methyl-1H-indazole are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science, owing to their diverse functionalization possibilities and the biological significance of indazole derivatives.
Formula:C8H6ClIN2
InChI:InChI=1S/C8H6ClIN2/c1-4-2-5-7(3-6(4)9)11-12-8(5)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=AWTFNUJGXGNPSE-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(Cl)=C(C)C2)NN1
Synonyms:
  • 6-Chloro-3-iodo-5-methyl-1H-indazole
  • 1H-Indazole, 6-chloro-3-iodo-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.