CymitQuimica logo

CAS 1260384-09-5

:

1,7-Bis(1,1-dimethylethyl) 4-aminoheptanedioate

Description:
1,7-Bis(1,1-dimethylethyl) 4-aminoheptanedioate, identified by its CAS number 1260384-09-5, is a chemical compound characterized by its unique structure that includes a heptanedioate backbone with amino and bulky tert-butyl substituents. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, while the bulky tert-butyl groups can impart steric hindrance, affecting its interaction with other molecules. Such characteristics may make it useful in applications ranging from pharmaceuticals to materials science, where specific reactivity and stability are desired. Additionally, the compound's molecular structure may lead to interesting physical properties, such as melting point and boiling point, which are influenced by the balance of polar and nonpolar regions within the molecule. Overall, 1,7-Bis(1,1-dimethylethyl) 4-aminoheptanedioate represents a versatile compound with potential utility in various chemical contexts.
Formula:C15H29NO4
InChI:InChI=1S/C15H29NO4/c1-14(2,3)19-12(17)9-7-11(16)8-10-13(18)20-15(4,5)6/h11H,7-10,16H2,1-6H3
InChI key:InChIKey=NQFYZBHGNBWQEK-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(CCC(CCC(OC(C)(C)C)=O)N)=O
Synonyms:
  • Heptanedioic acid, 4-amino-, 1,7-bis(1,1-dimethylethyl) ester
  • 1,7-Bis(1,1-dimethylethyl) 4-aminoheptanedioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.