CymitQuimica logo

CAS 1260384-81-3

:

4H-1,3-Dioxolo[4,5-c]pyrrole, tetrahydro-2,2-dimethyl-, hydrochloride (1:1), (3aR,6aS)-rel-

Description:
4H-1,3-Dioxolo[4,5-c]pyrrole, tetrahydro-2,2-dimethyl-, hydrochloride (1:1), (3aR,6aS)-rel- is a chemical compound characterized by its unique bicyclic structure, which includes a dioxole and pyrrole moiety. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its potential for various applications in organic synthesis and medicinal chemistry. The presence of the hydrochloride indicates that it is a salt form, which can enhance its stability and solubility in aqueous environments. The stereochemistry, denoted by (3aR,6aS)-rel-, suggests specific spatial arrangements of its atoms, which can significantly influence its biological activity and interactions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H13NO2·ClH
InChI:InChI=1/C7H13NO2.ClH/c1-7(2)9-5-3-8-4-6(5)10-7;/h5-6,8H,3-4H2,1-2H3;1H/t5-,6+;
InChI key:InChIKey=LLCAEDBOXIPEJI-KNCHESJLNA-N
SMILES:CC1(C)O[C@@]2([C@](O1)(CNC2)[H])[H].Cl
Synonyms:
  • 4H-1,3-Dioxolo[4,5-c]pyrrole, tetrahydro-2,2-dimethyl-, hydrochloride (1:1), (3aR,6aS)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.