CAS 1260385-32-7

6-Bromo-2-methyl-1H-indol-4-amine

Description:

6-Bromo-2-methyl-1H-indol-4-amine is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 6-position and a methyl group at the 2-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic indole framework. It is often utilized in medicinal chemistry and research due to its potential biological activity, including interactions with various biological targets. The amine functional group at the 4-position can participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical applications. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts. Overall, 6-Bromo-2-methyl-1H-indol-4-amine is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₉BrN₂

InChI: InChI=1S/C9H9BrN2/c1-5-2-7-8(11)3-6(10)4-9(7)12-5/h2-4,12H,11H2,1H3

InChI key: InChIKey=BMXGASYMFBVMQQ-UHFFFAOYSA-N

SMILES: NC1=C2C(NC(C)=C2)=CC(Br)=C1

Synonyms:

• 1H-Indol-4-amine, 6-bromo-2-methyl-
• 6-Bromo-2-methyl-1H-indol-4-amine
• 4-AMino-6-broMo-2-Methyl-1H-indole