CAS 1260385-40-7

1,7-Dihydro-5-nitro-6H-pyrrolo[2,3-b]pyridin-6-one

Description:

1,7-Dihydro-5-nitro-6H-pyrrolo[2,3-b]pyridin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a nitro group at the 5-position and a carbonyl group at the 6-position, contributing to its reactivity and potential biological activity. The presence of the nitro group often enhances the compound's ability to participate in electrophilic reactions, while the bicyclic framework can influence its solubility and interaction with biological targets. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in areas targeting specific enzymes or receptors. Additionally, the compound's stability, solubility, and reactivity can be influenced by the surrounding functional groups and the overall electronic environment. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₇H₅N₃O₃

InChI: InChI=1S/C7H5N3O3/c11-7-5(10(12)13)3-4-1-2-8-6(4)9-7/h1-3H,(H2,8,9,11)

InChI key: InChIKey=OENBTZBFXDVECG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC2=C(NC1=O)NC=C2

Synonyms:

• 1,7-Dihydro-5-nitro-6H-pyrrolo[2,3-b]pyridin-6-one
• 6H-Pyrrolo[2,3-b]pyridin-6-one, 1,7-dihydro-5-nitro-