CAS 1260385-54-3
:Methyl 6-chloro-2-methyl-1H-indole-4-carboxylate
Description:
Methyl 6-chloro-2-methyl-1H-indole-4-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position contributes to its unique reactivity and properties. The carboxylate functional group, indicated by the ester moiety (methyl ester), enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its specific reactivity can be attributed to the electron-withdrawing effects of the chlorine atom, which can affect nucleophilic attack during chemical reactions. Additionally, the indole framework is known for its presence in various natural products and its significance in medicinal chemistry, making this compound of interest for further research and application in drug development.
Formula:C11H10ClNO2
InChI:InChI=1S/C11H10ClNO2/c1-6-3-8-9(11(14)15-2)4-7(12)5-10(8)13-6/h3-5,13H,1-2H3
InChI key:InChIKey=CPHJWCRZXVOZJW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(NC(C)=C2)=CC(Cl)=C1
Synonyms:- 1H-Indole-4-carboxylic acid, 6-chloro-2-methyl-, methyl ester
- Methyl 6-chloro-2-methyl-1H-indole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.