CAS 1260385-55-4

1-(7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone

Description:

1-(7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone is a chemical compound characterized by its unique structure, which includes a pyrrolo[3,2-b]pyridine core substituted with a bromine atom and an ethanone functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of nitrogen atoms in its ring structure. The bromine substituent can influence the compound's reactivity and solubility, often enhancing its lipophilicity. Additionally, the ethanone moiety contributes to its potential as a precursor in organic synthesis or as an intermediate in the development of pharmaceuticals. The compound may also exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Overall, 1-(7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone represents a valuable structure in medicinal chemistry and materials science, warranting further investigation for its potential applications.

Formula: C₉H₇BrN₂O

InChI: InChI=1S/C9H7BrN2O/c1-5(13)6-4-12-9-7(10)2-3-11-8(6)9/h2-4,12H,1H3

InChI key: InChIKey=XVGXOQVCAQKNHK-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(NC1)=C(Br)C=CN2

Synonyms:

• 1-(7-Bromo-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone
• Ethanone, 1-(7-bromo-1H-pyrrolo[3,2-b]pyridin-3-yl)-