
CAS 1260385-58-7
:4-Chloro-2-iodo-1H-pyrrolo[2,3-c]pyridine
Description:
4-Chloro-2-iodo-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of chlorine and iodine substituents at specific positions on the pyrrolo structure enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the halogen substituents can influence the compound's electronic properties, potentially affecting its behavior in chemical reactions. As with many halogenated compounds, it is important to consider safety and environmental implications during handling and disposal. Overall, 4-Chloro-2-iodo-1H-pyrrolo[2,3-c]pyridine represents a valuable compound for research in various fields, including organic synthesis and pharmacology.
Formula:C7H4ClIN2
InChI:InChI=1S/C7H4ClIN2/c8-5-2-10-3-6-4(5)1-7(9)11-6/h1-3,11H
InChI key:InChIKey=ANLYASDXSNMDHS-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(I)=C2)=CN=C1
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine, 4-chloro-2-iodo-
- 4-Chloro-2-iodo-1H-pyrrolo[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.