CAS 1260385-59-8

1-(6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone

Description:

1-(6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone, identified by its CAS number 1260385-59-8, is a chemical compound that features a pyrrolopyridine core, which is a bicyclic structure known for its potential biological activity. This compound typically exhibits characteristics such as a moderate molecular weight and specific functional groups that influence its reactivity and solubility. The presence of the ethanone moiety suggests it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Its methyl substitution on the pyrrole ring can affect its electronic properties and steric hindrance, potentially impacting its interactions with biological targets. Compounds of this class are often studied for their pharmacological properties, including potential roles in medicinal chemistry. Additionally, the structural features may confer unique optical properties, making it of interest in material science and organic synthesis. Overall, this compound represents a fascinating area of study within the field of organic chemistry and drug development.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c1-6-3-9-10(12-4-6)8(5-11-9)7(2)13/h3-5,11H,1-2H3

InChI key: InChIKey=JKMHLFOTCRTMPL-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(NC1)=CC(C)=CN2

Synonyms:

• 1-(6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone
• Ethanone, 1-(6-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl)-