CymitQuimica logo

CAS 1260385-85-0

:

6-Methoxy-1H-pyrrolo[2,3-b]pyridin-5-amine

Description:
6-Methoxy-1H-pyrrolo[2,3-b]pyridin-5-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. This compound features a methoxy group (-OCH3) at the 6-position and an amino group (-NH2) at the 5-position of the pyrrolo-pyridine framework, contributing to its potential biological activity. The presence of these functional groups may influence its solubility, reactivity, and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential roles as enzyme inhibitors or in modulating neurotransmitter systems. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry are of interest, particularly in the development of new therapeutic agents. As with many heterocycles, its synthesis and characterization are essential for understanding its properties and potential uses in various chemical and pharmaceutical applications.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-12-8-6(9)4-5-2-3-10-7(5)11-8/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=QZHRRJFXNFXYRP-UHFFFAOYSA-N
SMILES:O(C)C=1N=C2C(=CC1N)C=CN2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-5-amine, 6-methoxy-
  • 6-Methoxy-1H-pyrrolo[2,3-b]pyridin-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.