CAS 1260386-37-5

1,9a-Dihydro-4-oxo-4H-pyrimido[1,2-b]pyridazine-3-carboxylic acid

Description:

1,9a-Dihydro-4-oxo-4H-pyrimido[1,2-b]pyridazine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both pyrimidine and pyridazine moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the 4-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The dihydro form suggests that the compound may exist in a saturated state, affecting its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific arrangement of atoms and functional groups in 1,9a-Dihydro-4-oxo-4H-pyrimido[1,2-b]pyridazine-3-carboxylic acid may also influence its interactions with biological targets, potentially leading to therapeutic applications. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c12-7-5(8(13)14)4-9-6-2-1-3-10-11(6)7/h1-4,6,9H,(H,13,14)

InChI key: InChIKey=JYBVUGWRLWEQOV-UHFFFAOYSA-N

SMILES: O=C1N2C(NC=C1C(O)=O)C=CC=N2

Synonyms:

• 1,9a-Dihydro-4-oxo-4H-pyrimido[1,2-b]pyridazine-3-carboxylic acid
• 4H-Pyrimido[1,2-b]pyridazine-3-carboxylic acid, 1,9a-dihydro-4-oxo-