CAS 1260386-49-9
:6-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
Description:
6-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a methyl group at the 6-position of the pyrrole ring and a cyano group (-C≡N) at the 3-position of the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the cyano group suggests potential reactivity, particularly in nucleophilic addition reactions. This compound may be of interest in medicinal chemistry and material science due to its structural features, which can influence biological activity and electronic properties. Additionally, its synthesis may involve multi-step organic reactions, including cyclization and functional group transformations. As with many heterocycles, it may also exhibit interesting photophysical properties, making it a candidate for further research in various applications, including pharmaceuticals and agrochemicals.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-6-2-3-8-7(4-10)5-11-9(8)12-6/h2-3,5H,1H3,(H,11,12)
InChI key:InChIKey=SGOHUDAELXBGSZ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NC1)=NC(C)=CC2
Synonyms:- 6-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
- 1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile, 6-methyl-
- 3-Cyano-6-Methyl-7-azaindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.