CAS 1260386-66-0

Ethyl 5-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Description:

Ethyl 5-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine framework. This compound features a chloro substituent at the 5-position and an ethyl ester functional group at the carboxylate position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the carbonyl group (2-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Its unique structure may impart specific biological activities, making it of interest in drug discovery and development. The compound is likely to exhibit moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. As with many heterocyclic compounds, it may also display interesting pharmacological properties, warranting further investigation into its potential therapeutic uses. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₁₀H₉ClN₂O₃

InChI: InChI=1S/C10H9ClN2O3/c1-2-16-10(15)7-8-5(12-9(7)14)3-4-6(11)13-8/h3-4,7H,2H2,1H3,(H,12,14)

InChI key: InChIKey=ZGEPCMUEIYSPDB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1C=2C(NC1=O)=CC=C(Cl)N2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 5-chloro-2,3-dihydro-2-oxo-, ethyl ester
• Ethyl 5-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[3,2-b]pyridine-3-carboxylate