CymitQuimica logo

CAS 1260387-10-7

:

6-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile

Description:
6-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of a bromine atom at the 6-position and a cyano group at the 3-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. The cyano group can participate in nucleophilic reactions, while the bromine atom can serve as a leaving group in various substitution reactions. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings, which can influence its behavior in chemical reactions and interactions with other molecules. Overall, 6-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile is a compound of significant interest in the field of organic and medicinal chemistry.
Formula:C8H4BrN3
InChI:InChI=1S/C8H4BrN3/c9-7-2-1-6-5(3-10)4-11-8(6)12-7/h1-2,4H,(H,11,12)
InChI key:InChIKey=SYXDIMKZYBSJLS-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NC1)=NC(Br)=CC2
Synonyms:
  • 6-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
  • 1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile, 6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.