CAS 126049-03-4
:NapsamycinA
Description:
Napsamycin A, with the CAS number 126049-03-4, is a natural product belonging to the class of macrolide antibiotics. It is primarily derived from the fermentation of specific strains of Streptomyces bacteria. Napsamycin A exhibits potent antibacterial and antifungal properties, making it of interest in pharmaceutical research and development. The compound is characterized by its complex molecular structure, which includes a large lactone ring and various functional groups that contribute to its biological activity. Its mechanism of action typically involves inhibition of protein synthesis in target organisms, which can lead to cell death. Additionally, Napsamycin A has shown potential in the treatment of certain cancers due to its ability to interfere with cellular processes. However, like many antibiotics, its use may be limited by issues such as resistance development and toxicity. Ongoing studies aim to better understand its pharmacological profile and explore its applications in medicine.
Formula:C39H48N8O12S
InChI:InChI=1/C39H48N8O12S/c1-20(45(2)33(52)28-16-23-15-25(49)8-7-22(23)18-41-28)32(40)35(54)47(19-26-17-30(50)36(59-26)46-11-9-31(51)44-39(46)58)34(53)27(10-12-60-3)42-38(57)43-29(37(55)56)14-21-5-4-6-24(48)13-21/h4-9,11,13,15,19-20,27-30,32,36,41,48-50H,10,12,14,16-18,40H2,1-3H3,(H,55,56)(H2,42,43,57)(H,44,51,58)/b26-19+/t20?,27-,28?,29?,30?,32?,36?/m0/s1
Synonyms:- MureidomycinF
- NapsamycinA
- 3,5,8,11-Tetraazadodecanoic acid, 9-[[[[5-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)dihydro-4-hydroxy-2(3H)-furanylidene]methyl]amino]carbonyl]-2-[(3-hydroxyphenyl)methyl]-10,11-dimethyl-6-[2-(methylthio)ethyl]-4,7,12-trioxo-12-(1,2,3,4-tetrahydro-6-hydroxy-3-isoquinolinyl)-
- N-{[(1S)-1-[(2-amino-3-{[(6-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl)carbonyl](methyl)amino}butanoyl){(E)-[5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-hydroxydihydrofuran-2(3H)-ylidene]methyl}carbamoyl]-3-(methylsulfanyl)propyl]carbamoyl}-3-hydroxyphenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Napsamycin A
CAS:Napsamycin A is an antibiotic with antibacterial activity against Pseudomonas aeruginosa and other Pseudomonas species, while exhibiting relatively weak activity against other gram-positive and gram-negative bacteria.Formula:C39H48N8O12SColor and Shape:SolidMolecular weight:852.91
