CAS 126050-30-4
:Nonanoic acid, compd. with 2-aminoethanol (1:1)
Description:
Nonanoic acid, compd. with 2-aminoethanol (1:1), is a chemical compound formed from the reaction between nonanoic acid, a nine-carbon straight-chain fatty acid, and 2-aminoethanol, an amino alcohol. This compound typically exhibits characteristics associated with both its components. Nonanoic acid contributes to its fatty, waxy odor and hydrophobic properties, while 2-aminoethanol introduces basicity and the potential for hydrogen bonding due to its amino and hydroxyl functional groups. The combination results in a substance that may have applications in surfactants, emulsifiers, or as a building block in organic synthesis. The presence of both a carboxylic acid and an amino alcohol suggests that the compound could participate in various chemical reactions, including esterification or amidation. Additionally, the compound's solubility may vary depending on the pH and the presence of other solvents, reflecting the amphiphilic nature of the components. Safety data should be consulted for handling and exposure guidelines, as both nonanoic acid and 2-aminoethanol can pose health risks in concentrated forms.
Formula:C9H18O2·C2H7NO
InChI:InChI=1S/C9H18O2.C2H7NO/c1-2-3-4-5-6-7-8-9(10)11;3-1-2-4/h2-8H2,1H3,(H,10,11);4H,1-3H2
InChI key:InChIKey=DGMWQSZIHTVJJY-UHFFFAOYSA-N
SMILES:C(CO)N.C(CCCCC)CCC(O)=O
Synonyms:- Nonanoic acid ethanolamine salt
- Nonanoic acid, compd. with 2-aminoethanol (1:1)
- Ethanol, 2-amino-, nonanoate (salt)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
