CAS 126052-25-3
:5,6,7,8-Tetrahydro-2-(1-methylethyl)imidazo[1,2-a]pyrazine
Description:
5,6,7,8-Tetrahydro-2-(1-methylethyl)imidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its bicyclic structure, which includes both imidazole and pyrazine rings. This compound features a saturated tetrahydro framework, contributing to its stability and unique chemical properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and potential interactions in biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various functional group modifications, which can lead to diverse pharmacological profiles. Additionally, the compound's CAS number, 126052-25-3, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical databases. Overall, 5,6,7,8-Tetrahydro-2-(1-methylethyl)imidazo[1,2-a]pyrazine represents a class of compounds that may have significant implications in pharmaceutical applications.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-7(2)8-6-12-4-3-10-5-9(12)11-8/h6-7,10H,3-5H2,1-2H3
InChI key:InChIKey=FSWUBMHGSRAQIY-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C2N(C1)CCNC2
Synonyms:- 2-Isopropyl-5,6,7,8-tetrahydro-imidazo[1,2-a]pyrazine
- 2-(Propan-2-yl)-5H,6H,7H,8H-imidazo[1,2-a]pyrazine
- 2-Propan-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine
- 5,6,7,8-Tetrahydro-2-(1-methylethyl)imidazo[1,2-a]pyrazine
- Imidazo[1,2-a]pyrazine, 5,6,7,8-tetrahydro-2-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.