
CAS 126055-14-9
:2-Ethyl-3-hydroxy-1-(2-methoxyethyl)-4(1H)-pyridinone
Description:
2-Ethyl-3-hydroxy-1-(2-methoxyethyl)-4(1H)-pyridinone, with the CAS number 126055-14-9, is a chemical compound characterized by its pyridinone structure, which features a hydroxyl group and an ethyl substituent. This compound typically exhibits properties associated with both polar and non-polar characteristics due to the presence of the methoxyethyl group, which can enhance its solubility in various solvents. The hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. Additionally, the compound may display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, 2-Ethyl-3-hydroxy-1-(2-methoxyethyl)-4(1H)-pyridinone is a versatile compound with potential applications in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-3-8-10(13)9(12)4-5-11(8)6-7-14-2/h4-5,13H,3,6-7H2,1-2H3
InChI key:InChIKey=BTFUQSCMGAOMNO-UHFFFAOYSA-N
SMILES:C(C)C=1N(CCOC)C=CC(=O)C1O
Synonyms:- 2-Ethyl-3-hydroxy-1-(2-methoxyethyl)-1,4-dihydropyridin-4-one
- 2-Ethyl-3-hydroxy-1-(2-methoxyethyl)-4(1H)-pyridinone
- 2-Ethyl-3-hydroxy-1-(2-methoxyethyl)pyridin-4-one
- CP 96
- 4(1H)-Pyridinone, 2-ethyl-3-hydroxy-1-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.