
CAS 126055-15-0
:3-Hydroxy-2-methyl-1-(2-propen-1-yl)-4(1H)-pyridinone
Description:
3-Hydroxy-2-methyl-1-(2-propen-1-yl)-4(1H)-pyridinone, with the CAS number 126055-15-0, is an organic compound characterized by its pyridinone structure, which features a hydroxyl group and a propenyl side chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. The methyl and propenyl substituents can affect its steric and electronic properties, potentially enhancing its reactivity in various chemical reactions. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-3-5-10-6-4-8(11)9(12)7(10)2/h3-4,6,12H,1,5H2,2H3
InChI key:InChIKey=FPIZVOQFIJHWIS-UHFFFAOYSA-N
SMILES:C(C=C)N1C(C)=C(O)C(=O)C=C1
Synonyms:- 4(1H)-Pyridinone, 3-hydroxy-2-methyl-1-(2-propenyl)-
- 3-Hydroxy-2-methyl-1-(2-propen-1-yl)-4(1H)-pyridinone
- 4(1H)-Pyridinone, 3-hydroxy-2-methyl-1-(2-propen-1-yl)-
- 1-Allyl-3-hydroxy-2-methyl-1H-pyridin-4-one
- L 1NAII
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.