
CAS 1260590-42-8
:(βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid
Description:
The chemical substance known as (βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid, with the CAS number 1260590-42-8, is a synthetic amino acid derivative. It features a cyclopentane backbone, which contributes to its unique three-dimensional structure, and is characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly used in peptide synthesis to protect amino groups. This compound is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and proteins. The Fmoc group allows for selective deprotection under mild basic conditions, facilitating the stepwise assembly of peptide chains. The stereochemistry indicated by (βR) suggests that the compound has a specific spatial arrangement, which can influence its biological activity and interactions. Overall, this substance is significant in research and applications involving peptide synthesis, drug development, and the study of protein structure and function.
Formula:C23H25NO4
InChI:InChI=1S/C23H25NO4/c25-22(26)13-21(15-7-1-2-8-15)24-23(27)28-14-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20/h3-6,9-12,15,20-21H,1-2,7-8,13-14H2,(H,24,27)(H,25,26)/t21-/m1/s1
InChI key:InChIKey=UUHBRVGMVCJAAL-OAQYLSRUSA-N
SMILES:C(OC(N[C@H](CC(O)=O)C1CCCC1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- Cyclopentanepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (βR)-
- (βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.