CAS 1260591-71-6

(βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzenepropanoic acid

Description:

The chemical substance known as (βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzenepropanoic acid is a synthetic compound that features a complex structure characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis. This compound contains a propanoic acid moiety, indicating it has acidic properties, and the presence of methoxy groups suggests it may exhibit unique electronic and steric characteristics. The β-amino acid structure implies that it may participate in various biochemical interactions, potentially influencing its solubility and reactivity. The chirality at the β position indicates that the compound exists in a specific stereoisomeric form, which can significantly affect its biological activity and interactions with enzymes or receptors. Overall, this compound is of interest in medicinal chemistry and peptide synthesis, where its unique structural features may be leveraged for the development of novel therapeutic agents.

Formula: C₂₆H₂₅NO₆

InChI: InChI=1S/C26H25NO6/c1-31-16-11-12-21(24(13-16)32-2)23(14-25(28)29)27-26(30)33-15-22-19-9-5-3-7-17(19)18-8-4-6-10-20(18)22/h3-13,22-23H,14-15H2,1-2H3,(H,27,30)(H,28,29)/t23-/m1/s1

InChI key: InChIKey=VFNKJIZSIZCUPV-HSZRJFAPSA-N

SMILES: C(OC(N[C@H](CC(O)=O)C1=C(OC)C=C(OC)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• (βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzenepropanoic acid
• Benzenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxy-, (βR)-