CAS 1260606-19-6

(αR)-α-Amino-2-chlorobenzenebutanoic acid

Description:

(αR)-α-Amino-2-chlorobenzenebutanoic acid, identified by its CAS number 1260606-19-6, is a chiral amino acid derivative characterized by the presence of both an amino group and a carboxylic acid group, which are typical functional groups in amino acids. The molecule features a chlorobenzene ring, indicating the presence of a chlorine substituent on the aromatic ring, which can influence its reactivity and biological activity. The specific stereochemistry denoted by (αR) suggests that the amino group is oriented in a particular spatial arrangement, which can affect the compound's interactions with biological systems, including enzyme binding and receptor activity. This compound may exhibit properties relevant to pharmaceutical applications, particularly in the development of drugs targeting specific pathways or conditions. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications. Overall, (αR)-α-Amino-2-chlorobenzenebutanoic acid represents a unique structure with potential significance in medicinal chemistry and biochemistry.

Formula: C₁₀H₁₂ClNO₂

InChI: InChI=1S/C10H12ClNO2/c11-8-4-2-1-3-7(8)5-6-9(12)10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1

InChI key: InChIKey=ZYQDUOLAVXZHAL-SECBINFHSA-N

SMILES: C(C[C@H](C(O)=O)N)C1=C(Cl)C=CC=C1

Synonyms:

• (r)-2-Amino-4-(2-chloro-phenyl)-butyric acid
• (αR)-α-Amino-2-chlorobenzenebutanoic acid
• Benzenebutanoic acid, α-amino-2-chloro-, (αR)-
• (2R)-2-Amino-4-(2-chlorophenyl)butanoic acid