CAS 1260606-37-8

(αR)-α-Amino-2-bromobenzenebutanoic acid

Description:

(αR)-α-Amino-2-bromobenzenebutanoic acid, with the CAS number 1260606-37-8, is a chemical compound characterized by its amino acid structure, which includes a bromobenzene moiety. This compound features a chiral center, indicated by the (αR) designation, which implies that it exists in a specific stereoisomeric form. The presence of the bromine atom on the benzene ring contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The butanoic acid side chain provides additional functional groups that can participate in various chemical reactions, making it versatile in synthetic pathways. Its solubility and stability in different solvents can vary, depending on the pH and temperature conditions. As an amino acid derivative, it may exhibit biological activity, potentially influencing protein synthesis or acting as a neurotransmitter precursor. Overall, this compound's unique structural features and functional groups make it of interest in both research and industrial applications.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c11-8-4-2-1-3-7(8)5-6-9(12)10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1

InChI key: InChIKey=OMFRQEMZOQGSSC-SECBINFHSA-N

SMILES: C(C[C@H](C(O)=O)N)C1=C(Br)C=CC=C1

Synonyms:

• Benzenebutanoic acid, α-amino-2-bromo-, (αR)-
• (αR)-α-Amino-2-bromobenzenebutanoic acid