CAS 1260614-59-2

(αR)-α-(Aminomethyl)-4-bromobenzenepropanoic acid

Description:

(αR)-α-(Aminomethyl)-4-bromobenzenepropanoic acid, identified by its CAS number 1260614-59-2, is a chemical compound characterized by its structural features, which include a bromobenzene ring and an amino acid backbone. This compound possesses both an amine and a carboxylic acid functional group, making it an amino acid derivative. The presence of the bromine atom on the benzene ring contributes to its reactivity and potential applications in organic synthesis. The (αR) designation indicates the specific stereochemistry of the compound, which can influence its biological activity and interactions. Typically, such compounds may exhibit properties relevant to pharmaceuticals, particularly in the context of drug design and development, due to their ability to interact with biological systems. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1

InChI key: InChIKey=GKIMDBLWVUDOQG-MRVPVSSYSA-N

SMILES: C([C@@H](C(O)=O)CN)C1=CC=C(Br)C=C1

Synonyms:

• Benzenepropanoic acid, α-(aminomethyl)-4-bromo-, (αR)-
• (αR)-α-(Aminomethyl)-4-bromobenzenepropanoic acid