
CAS 1260619-31-5
:(αR)-α-Amino-2-benzofuranacetic acid
Description:
(αR)-α-Amino-2-benzofuranacetic acid, identified by its CAS number 1260619-31-5, is an amino acid derivative characterized by the presence of a benzofuran moiety. This compound features a chiral center, which contributes to its stereochemical properties, specifically the (αR) configuration. The benzofuran structure imparts unique electronic and steric characteristics, influencing its reactivity and potential biological activity. As an amino acid, it contains both an amino group (-NH2) and a carboxylic acid group (-COOH), which are fundamental to its classification and behavior in biochemical processes. The compound may exhibit solubility in polar solvents, and its interactions with biological systems could be significant, potentially affecting neurotransmitter pathways or serving as a building block for peptide synthesis. Its specific applications and effects would depend on further research into its pharmacological properties and mechanisms of action. Overall, (αR)-α-Amino-2-benzofuranacetic acid represents a compound of interest in medicinal chemistry and drug development.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c11-9(10(12)13)8-5-6-3-1-2-4-7(6)14-8/h1-5,9H,11H2,(H,12,13)/t9-/m1/s1
InChI key:InChIKey=PQSKXCUSMBAOPA-SECBINFHSA-N
SMILES:[C@@H](C(O)=O)(N)C1=CC=2C(O1)=CC=CC2
Synonyms:- (αR)-α-Amino-2-benzofuranacetic acid
- 2-Benzofuranacetic acid, α-amino-, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.