CAS 1260619-36-0

(3R,6S)-3,6-Dimethyl-2-piperazinone

Description:

(3R,6S)-3,6-Dimethyl-2-piperazinone is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. The specific stereochemistry indicated by the (3R,6S) notation suggests that the compound has distinct spatial arrangements at the 3rd and 6th carbon positions, contributing to its potential biological activity and interaction with other molecules. This compound features two methyl groups attached to the piperazine ring, which can influence its solubility, reactivity, and overall pharmacological properties. As a piperazinone derivative, it may exhibit properties relevant to medicinal chemistry, including potential use as a pharmaceutical agent or in the development of new therapeutic compounds. The presence of the carbonyl group in the piperazinone structure can also play a significant role in its reactivity and interactions with biological targets. Overall, (3R,6S)-3,6-Dimethyl-2-piperazinone is of interest in various fields, including organic synthesis and drug development, due to its unique structural features and potential applications.

Formula: C₆H₁₂N₂O

InChI: InChI=1S/C6H12N2O/c1-4-3-7-5(2)6(9)8-4/h4-5,7H,3H2,1-2H3,(H,8,9)/t4-,5+/m0/s1

InChI key: InChIKey=NJAPKTOYEVZXOF-CRCLSJGQSA-N

SMILES: O=C1[C@@H](C)NC[C@H](C)N1

Synonyms:

• (3R,6S)-3,6-Dimethyl-2-piperazinone
• 2-Piperazinone, 3,6-dimethyl-, (3R,6S)-