CAS 126062-18-8
:cyclobutg
Description:
Cyclobutg, identified by the CAS number 126062-18-8, is a chemical compound that belongs to the class of cyclic organic compounds. It features a four-membered carbon ring structure, which is characteristic of cyclobutane derivatives. The compound is notable for its unique ring strain due to the angle strain associated with the four-membered ring, which can influence its reactivity and stability. Cyclobutg may exhibit properties typical of cyclic alkenes, including potential for undergoing various chemical reactions such as ring-opening or addition reactions. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific substituents attached to the cyclobutane ring. Additionally, the compound's applications could span various fields, including organic synthesis and materials science, depending on its reactivity and functionalization potential. As with any chemical substance, safety data and handling precautions should be consulted to ensure safe usage in laboratory or industrial settings.
Formula:C11H15N5O3
InChI:InChI=1/C11H15N5O3/c12-11-14-9-8(10(19)15-11)13-4-16(9)7-1-5(2-17)6(7)3-18/h4-7,17-18H,1-3H2,(H3,12,14,15,19)/t5-,6-,7+/m1/s1
Synonyms:- SQ 33054
- 9-(2,3-Bis-(hydroxymethyl)-1-cyclobutyl)guanine
- 2-amino-9-[(1S,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-3,9-dihydro-6H-purin-6-one
- Cyclobut-G
- 6H-Purin-6-one, 2-amino-9-((1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl)-1,9-dihydro-, rel-
- Carbocyclic oxetanocin G
- 6H-Purin-6-one, 2-amino-9-(2,3-bis(hydroxymethyl)cyclobutyl)-1,9-dihydro-, (1alpha,2beta,3alpha)-(+-)-
- 2-Amino-9-(2,3-bis(hydroxymethyl)cyclobutyl)-1,9-dihydro-6H-purin-6-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(rel)-Lobucavir
CAS:<p>Lobucavir inhibits the replication of the HIV virus in T cells, monocytes & macrophages in vitro by inhibiting DNA polymerase and viral DNA synthesis.</p>Formula:C11H15N5O3Purity:98%Color and Shape:SolidMolecular weight:265.27
