CAS 1260636-78-9

α-Amino-4-(1-methylethyl)benzenebutanoic acid

Description:

α-Amino-4-(1-methylethyl)benzenebutanoic acid, also known as a derivative of phenylalanine, is an amino acid characterized by its structure, which includes an amino group, a carboxylic acid group, and a phenyl ring with an isopropyl substituent. This compound is typically classified as a non-polar, hydrophobic amino acid due to the presence of the isopropyl group, which influences its solubility and interactions in biological systems. It plays a role in protein synthesis and may be involved in various metabolic pathways. The presence of both the amino and carboxylic acid functional groups allows it to participate in peptide bond formation, making it relevant in the context of polypeptide and protein structure. Additionally, its unique side chain can affect the folding and stability of proteins, as well as their interactions with other biomolecules. The compound's specific properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the environment in which it is studied.

Formula: C₁₃H₁₉NO₂

InChI: InChI=1S/C13H19NO2/c1-9(2)11-6-3-10(4-7-11)5-8-12(14)13(15)16/h3-4,6-7,9,12H,5,8,14H2,1-2H3,(H,15,16)

InChI key: InChIKey=QXTNPVIJOCZFSN-UHFFFAOYSA-N

SMILES: C(CC(C(O)=O)N)C1=CC=C(C(C)C)C=C1

Synonyms:

• Benzenebutanoic acid, α-amino-4-(1-methylethyl)-
• α-Amino-4-(1-methylethyl)benzenebutanoic acid