CymitQuimica logo

CAS 1260637-15-7

:

1-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methoxycyclopentanecarboxylic acid

Description:
1-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methoxycyclopentanecarboxylic acid is a chemical compound characterized by its complex structure, which includes a cyclopentane ring substituted with various functional groups. The presence of an amino group and a carboxylic acid group indicates that it can participate in both acid-base reactions and form amide bonds. The dimethylethoxycarbonyl group serves as a protective group for the amino functionality, enhancing the compound's stability and reactivity in synthetic applications. Additionally, the methoxy group contributes to the compound's polarity and solubility properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific stereochemistry and functional group arrangement can influence its reactivity and interactions with biological targets. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a versatile structure with potential applications in medicinal chemistry and organic synthesis.
Formula:C12H21NO5
InChI:InChI=1S/C12H21NO5/c1-11(2,3)18-10(16)13-12(9(14)15)6-5-8(7-12)17-4/h8H,5-7H2,1-4H3,(H,13,16)(H,14,15)
InChI key:InChIKey=QTVILWKSHUHYPB-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(C(O)=O)CC(OC)CC1
Synonyms:
  • 1-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-methoxycyclopentanecarboxylic acid
  • Cyclopentanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.