CAS 1260637-75-9

6-Chloro-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid

Description:

6-Chloro-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline framework and multiple chlorine substituents. The presence of the chloro groups enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many isoquinoline derivatives. Its molecular structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or exhibiting anti-inflammatory properties. The carboxylic acid functional group contributes to its acidity and reactivity, allowing for further derivatization or conjugation in synthetic applications. As with many halogenated compounds, it may also display unique environmental behavior and toxicity profiles, necessitating careful handling and assessment in laboratory settings. Overall, this compound represents a significant interest in the fields of organic synthesis and pharmacology.

Formula: C₁₆H₁₂Cl₃NO₂

InChI: InChI=1S/C16H12Cl3NO2/c17-10-1-3-12-9(7-10)5-6-20(15(12)16(21)22)14-4-2-11(18)8-13(14)19/h1-4,7-8,15H,5-6H2,(H,21,22)

InChI key: InChIKey=OXVOOMKBZMFVJN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1N(CCC=2C1=CC=C(Cl)C2)C3=C(Cl)C=C(Cl)C=C3

Synonyms:

• 1-Isoquinolinecarboxylic acid, 6-chloro-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydro-
• 6-Chloro-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid